|
CAS#: 84604-91-1 Product: 1,1'-Methylenebis(4-chloro-2-methylbenzene) No suppilers available for the product. |
| Name | 1,1'-Methylenebis(4-chloro-2-methylbenzene) |
|---|---|
| Synonyms | 2,2'-methylenebis[5-chlorotoluene] |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14Cl2 |
| Molecular Weight | 265.18 |
| CAS Registry Number | 84604-91-1 |
| EINECS | 283-376-0 |
| SMILES | Clc2cc(C)c(Cc1ccc(Cl)cc1C)cc2 |
| InChI | 1S/C15H14Cl2/c1-10-7-14(16)5-3-12(10)9-13-4-6-15(17)8-11(13)2/h3-8H,9H2,1-2H3 |
| InChIKey | GWWGPHYWSMOSOL-UHFFFAOYSA-N |
| Density | 1.177g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.154°C at 760 mmHg (Cal.) |
| Flash point | 160.872°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-Methylenebis(4-chloro-2-methylbenzene) |