|
CAS#: 84605-05-0 Product: N-Nitroso-N-Methyl-3-Aminomethylindole No suppilers available for the product. |
| Name | N-Nitroso-N-Methyl-3-Aminomethylindole |
|---|---|
| Synonyms | N-(1H-Indol-3-Ylmethyl)-N-Methyl-Nitrous Amide; 1H-Indole-3-Methanamine, N-Methyl-N-Nitroso-; N-Nitroso-N-Methyl-3-Aminomethylindole |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 |
| CAS Registry Number | 84605-05-0 |
| SMILES | C1=C(C2=C([NH]1)C=CC=C2)CN(N=O)C |
| InChI | 1S/C10H11N3O/c1-13(12-14)7-8-6-11-10-5-3-2-4-9(8)10/h2-6,11H,7H2,1H3 |
| InChIKey | WEFCHZVJIDHTIY-UHFFFAOYSA-N |
| Density | 1.235g/cm3 (Cal.) |
|---|---|
| Boiling point | 445.499°C at 760 mmHg (Cal.) |
| Flash point | 223.23°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Nitroso-N-Methyl-3-Aminomethylindole |