|
CAS#: 84680-30-8 Product: (2Z,4E,6Z,8E)-N-Butyl-3,7-Dimethyl-9-(2,6,6-Trimethyl-1-Cyclohexenyl)Nona-2,4,6,8-Tetraenamide No suppilers available for the product. |
| Name | (2Z,4E,6Z,8E)-N-Butyl-3,7-Dimethyl-9-(2,6,6-Trimethyl-1-Cyclohexenyl)Nona-2,4,6,8-Tetraenamide |
|---|---|
| Synonyms | 13-Cis-N-(Butyl)Retinamide; Ccris 4302; Retinamide, N-Butyl-, 13-Cis- |
| Molecular Structure | ![]() |
| Molecular Formula | C24H37NO |
| Molecular Weight | 355.56 |
| CAS Registry Number | 84680-30-8 |
| SMILES | C(NC(=O)/C=C(\C=C\C=C(/C=C/C1=C(CCCC1(C)C)C)C)C)CCC |
| InChI | 1S/C24H37NO/c1-7-8-17-25-23(26)18-20(3)12-9-11-19(2)14-15-22-21(4)13-10-16-24(22,5)6/h9,11-12,14-15,18H,7-8,10,13,16-17H2,1-6H3,(H,25,26)/b12-9+,15-14+,19-11-,20-18- |
| InChIKey | IOIMWLSSNSWJLN-BFYOQURKSA-N |
| Density | 0.949g/cm3 (Cal.) |
|---|---|
| Boiling point | 525.612°C at 760 mmHg (Cal.) |
| Flash point | 324.903°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2Z,4E,6Z,8E)-N-Butyl-3,7-Dimethyl-9-(2,6,6-Trimethyl-1-Cyclohexenyl)Nona-2,4,6,8-Tetraenamide |