|
CAS#: 84681-92-5 Product: 8-Ethyl-1,5-Dimethylbicyclo[3.2.1]Octan-8-Ol No suppilers available for the product. |
| Name | 8-Ethyl-1,5-Dimethylbicyclo[3.2.1]Octan-8-Ol |
|---|---|
| Synonyms | 8-Ethyl-1,5-Dimethyl-Bicyclo[3.2.1]Octan-8-Ol; 8-Ethyl-1,5-Dimethyl-8-Bicyclo[3.2.1]Octanol; 8-Ethyl-1,5-Dimethylbicyclo(3.2.1)Octan-8-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 |
| CAS Registry Number | 84681-92-5 |
| EINECS | 283-553-2 |
| SMILES | C(C1(C2(CCCC1(CC2)C)C)O)C |
| InChI | 1S/C12H22O/c1-4-12(13)10(2)6-5-7-11(12,3)9-8-10/h13H,4-9H2,1-3H3 |
| InChIKey | AKVDDUFUTRWZKY-UHFFFAOYSA-N |
| Density | 0.983g/cm3 (Cal.) |
|---|---|
| Boiling point | 232.05°C at 760 mmHg (Cal.) |
| Flash point | 94.672°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Ethyl-1,5-Dimethylbicyclo[3.2.1]Octan-8-Ol |