|
CAS#: 84682-18-8 Product: 4-(Isopentyl)Benzaldehyde No suppilers available for the product. |
| Name | 4-(Isopentyl)Benzaldehyde |
|---|---|
| Synonyms | 4-Isopentylbenzaldehyde; 4-Isoamylbenzaldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 |
| CAS Registry Number | 84682-18-8 |
| EINECS | 283-579-4 |
| SMILES | C1=C(C=O)C=CC(=C1)CCC(C)C |
| InChI | 1S/C12H16O/c1-10(2)3-4-11-5-7-12(9-13)8-6-11/h5-10H,3-4H2,1-2H3 |
| InChIKey | HWVKHXKLEJRRJU-UHFFFAOYSA-N |
| Density | 0.959g/cm3 (Cal.) |
|---|---|
| Boiling point | 269.006°C at 760 mmHg (Cal.) |
| Flash point | 107.545°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Isopentyl)Benzaldehyde |