|
CAS#: 84682-13-3 Product: 3-(3,3-Dimethylbicyclo[2.2.1]hept-5-en-2-yl)-2-butenal No suppilers available for the product. |
| Name | 3-(3,3-Dimethylbicyclo[2.2.1]hept-5-en-2-yl)-2-butenal |
|---|---|
| Synonyms | 3-(3,3-dimethylbicyclo[2.2.1]hept-5-en-2-yl)-2-butenal |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28 |
| CAS Registry Number | 84682-13-3 |
| EINECS | 283-574-7 |
| SMILES | CC2(C)C1\C=C/C(C1)C2C(C)=CC=O |
| InChI | 1S/C13H18O/c1-9(6-7-14)12-10-4-5-11(8-10)13(12,2)3/h4-7,10-12H,8H2,1-3H3 |
| InChIKey | QCXOQARCPZNLPI-UHFFFAOYSA-N |
| Density | 0.977g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.011°C at 760 mmHg (Cal.) |
| Flash point | 127.153°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(3,3-Dimethylbicyclo[2.2.1]hept-5-en-2-yl)-2-butenal |