|
CAS#: 84682-29-1 Product: 3-Chloro-3-(4-Chlorophenyl)Methacrylaldehyde No suppilers available for the product. |
| Name | 3-Chloro-3-(4-Chlorophenyl)Methacrylaldehyde |
|---|---|
| Synonyms | (Z)-3-Chloro-3-(4-Chlorophenyl)-2-Methyl-Prop-2-Enal; (Z)-3-Chloro-3-(4-Chlorophenyl)-2-Methyl-Acrolein; 3-Chloro-3-(4-Chlorophenyl)Methacrylaldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8Cl2O |
| Molecular Weight | 215.08 |
| CAS Registry Number | 84682-29-1 |
| EINECS | 283-592-5 |
| SMILES | C1=C(Cl)C=CC(=C1)\C(Cl)=C(C=O)/C |
| InChI | 1S/C10H8Cl2O/c1-7(6-13)10(12)8-2-4-9(11)5-3-8/h2-6H,1H3/b10-7- |
| InChIKey | BHJZUQREERYDNK-YFHOEESVSA-N |
| Density | 1.26g/cm3 (Cal.) |
|---|---|
| Boiling point | 307.487°C at 760 mmHg (Cal.) |
| Flash point | 129.036°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-3-(4-Chlorophenyl)Methacrylaldehyde |