|
CAS#: 84697-11-0 Product: 5,5-Dimethyl-2-(1-Phenylethyl)-1,3-Dioxane No suppilers available for the product. |
| Name | 5,5-Dimethyl-2-(1-Phenylethyl)-1,3-Dioxane |
|---|---|
| Synonyms | Nsc40516 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 |
| CAS Registry Number | 84697-11-0 |
| EINECS | 283-721-5 |
| SMILES | C2=C(C(C1OCC(CO1)(C)C)C)C=CC=C2 |
| InChI | 1S/C14H20O2/c1-11(12-7-5-4-6-8-12)13-15-9-14(2,3)10-16-13/h4-8,11,13H,9-10H2,1-3H3 |
| InChIKey | CYSFBBKZAKVSNZ-UHFFFAOYSA-N |
| Density | 0.99g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.321°C at 760 mmHg (Cal.) |
| Flash point | 135.327°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5-Dimethyl-2-(1-Phenylethyl)-1,3-Dioxane |