|
CAS#: 84736-60-7 Product: N-Formyl-4-Nitrophenylhydroxylamine No suppilers available for the product. |
| Name | N-Formyl-4-Nitrophenylhydroxylamine |
|---|---|
| Synonyms | N-Hydroxy-N-(4-Nitrophenyl)Methanamide; Ccris 5517; Formamide, N-Hydroxy-N-(4-Nitrophenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6N2O4 |
| Molecular Weight | 182.14 |
| CAS Registry Number | 84736-60-7 |
| SMILES | C1=C(N(O)C=O)C=CC(=C1)[N+]([O-])=O |
| InChI | 1S/C7H6N2O4/c10-5-8(11)6-1-3-7(4-2-6)9(12)13/h1-5,11H |
| InChIKey | QRYSGJONVHFLGS-UHFFFAOYSA-N |
| Density | 1.549g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.293°C at 760 mmHg (Cal.) |
| Flash point | 195.286°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Formyl-4-Nitrophenylhydroxylamine |