|
CAS#: 84761-81-9 Product: 1,2,8-Tribromodibenzofuran No suppilers available for the product. |
| Name | 1,2,8-Tribromodibenzofuran |
|---|---|
| Synonyms | 1,2,8-Tribromo-Dibenzofuran |
| Molecular Structure | ![]() |
| Molecular Formula | C12H5Br3O |
| Molecular Weight | 404.88 |
| CAS Registry Number | 84761-81-9 |
| SMILES | C1=C3C(=C(C(=C1)Br)Br)C2=CC(=CC=C2O3)Br |
| InChI | 1S/C12H5Br3O/c13-6-1-3-9-7(5-6)11-10(16-9)4-2-8(14)12(11)15/h1-5H |
| InChIKey | LQKAHTKRUKHSDG-UHFFFAOYSA-N |
| Density | 2.142g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.435°C at 760 mmHg (Cal.) |
| Flash point | 224.401°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,8-Tribromodibenzofuran |