|
CAS#: 84803-49-6 Product: Bis(5-chloro-8-hydroxyquinolinium) sulfate No suppilers available for the product. |
| Name | Bis(5-chloro-8-hydroxyquinolinium) sulfate |
|---|---|
| Synonyms | bis(5-chloro-8-hydroxyquinolinium) sulphate |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14Cl2N2O6S |
| Molecular Weight | 457.28 |
| CAS Registry Number | 84803-49-6 |
| EINECS | 284-175-0 |
| SMILES | [O-]S([O-])(=O)=O.Oc1ccc(Cl)c2ccc[nH+]c12.Oc1ccc(Cl)c2ccc[nH+]c12 |
| InChI | 1S/2C9H6ClNO.H2O4S/c2*10-7-3-4-8(12)9-6(7)2-1-5-11-9;1-5(2,3)4/h2*1-5,12H;(H2,1,2,3,4) |
| InChIKey | DCHJUHZBQRBJFU-UHFFFAOYSA-N |
| Boiling point | 760.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 413.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(5-chloro-8-hydroxyquinolinium) sulfate |