|
CAS#: 84803-51-0 Product: N-(2-Amino-6-Chlorophenyl)-N-Phenylacetamide No suppilers available for the product. |
| Name | N-(2-Amino-6-Chlorophenyl)-N-Phenylacetamide |
|---|---|
| Synonyms | N-(2-Amino-6-Chloro-Phenyl)-N-Phenyl-Acetamide; N-(2-Amino-6-Chloro-Phenyl)-N-Phenyl-Ethanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13ClN2O |
| Molecular Weight | 260.72 |
| CAS Registry Number | 84803-51-0 |
| EINECS | 284-177-1 |
| SMILES | C1=C(Cl)C(=C(N)C=C1)N(C(=O)C)C2=CC=CC=C2 |
| InChI | 1S/C14H13ClN2O/c1-10(18)17(11-6-3-2-4-7-11)14-12(15)8-5-9-13(14)16/h2-9H,16H2,1H3 |
| InChIKey | LGXWAYKZEYBMGW-UHFFFAOYSA-N |
| Density | 1.292g/cm3 (Cal.) |
|---|---|
| Boiling point | 492.486°C at 760 mmHg (Cal.) |
| Flash point | 251.647°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Amino-6-Chlorophenyl)-N-Phenylacetamide |