|
CAS#: 84803-71-4 Product: 1,5-Bis(4-Chlorophenyl)-2,5-Dihydro-2,2-Dimethyl-1H-Imidazo[4,5-b]Phenazine No suppilers available for the product. |
| Name | 1,5-Bis(4-Chlorophenyl)-2,5-Dihydro-2,2-Dimethyl-1H-Imidazo[4,5-b]Phenazine |
|---|---|
| Synonyms | 3,10-Bis(4-Chlorophenyl)-2,2-Dimethyl-Imidazo[5,4-B]Phenazine; 1H-Imidazo[4,5-B]Phenazine, 1,5-Bis(4-Chlorophenyl)-2,5-Dihydro-2,2-Dimethyl-; Aids-010727 |
| Molecular Structure | ![]() |
| Molecular Formula | C27H20Cl2N4 |
| Molecular Weight | 471.39 |
| CAS Registry Number | 84803-71-4 |
| EINECS | 284-199-1 |
| SMILES | C6=C(N1C(N=C3C1=CC2=NC5=C(N(C2=C3)C4=CC=C(Cl)C=C4)C=CC=C5)(C)C)C=CC(=C6)Cl |
| InChI | 1S/C27H20Cl2N4/c1-27(2)31-23-16-25-22(15-26(23)33(27)20-13-9-18(29)10-14-20)30-21-5-3-4-6-24(21)32(25)19-11-7-17(28)8-12-19/h3-16H,1-2H3 |
| InChIKey | HFSRYMCNSIJDJB-UHFFFAOYSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Boiling point | 572.989°C at 760 mmHg (Cal.) |
| Flash point | 300.333°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Bis(4-Chlorophenyl)-2,5-Dihydro-2,2-Dimethyl-1H-Imidazo[4,5-b]Phenazine |