|
CAS#: 84812-30-6 Product: 6,6-Dimethyltetrahydropterin No suppilers available for the product. |
| Name | 6,6-Dimethyltetrahydropterin |
|---|---|
| Synonyms | 4(1H)-Pteridinone, 2-Amino-5,6,7,8-Tetrahydro-6,6-Dimethyl-; 6,6-Dimethyltetrahydropterin; 6,6-Me2ph4 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.22 |
| CAS Registry Number | 84812-30-6 |
| SMILES | CC2(NC1=C(NC(=NC1=O)N)NC2)C |
| InChI | 1S/C8H13N5O/c1-8(2)3-10-5-4(13-8)6(14)12-7(9)11-5/h13H,3H2,1-2H3,(H4,9,10,11,12,14) |
| InChIKey | PAUJITBZUCOBIJ-UHFFFAOYSA-N |
| Density | 1.615g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.964°C at 760 mmHg (Cal.) |
| Flash point | 160.614°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,6-Dimethyltetrahydropterin |