Online Database of Chemicals from Around the World
|
CAS#: 84812-71-5 Product: 4-(3-Oxobutyl)Phenyl Isovalerate No suppilers available for the product. |
| Name | 4-(3-Oxobutyl)Phenyl Isovalerate |
|---|---|
| Synonyms | 3-Methylbutanoic Acid [4-(3-Oxobutyl)Phenyl] Ester; 3-Methylbutyric Acid [4-(3-Ketobutyl)Phenyl] Ester; 4-(3-Oxobutyl)Phenyl Isovalerate |
| Molecular Structure |  |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 |
| CAS Registry Number | 84812-71-5 |
| EINECS | 284-215-7 |
| SMILES | C1=C(OC(=O)CC(C)C)C=CC(=C1)CCC(=O)C |
| InChI | 1S/C15H20O3/c1-11(2)10-15(17)18-14-8-6-13(7-9-14)5-4-12(3)16/h6-9,11H,4-5,10H2,1-3H3 |
| InChIKey | TXFRWSBGEBFNFP-UHFFFAOYSA-N |
| Density | 1.035g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.504°C at 760 mmHg (Cal.) |
| Flash point | 151.226°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3-Oxobutyl)Phenyl Isovalerate |