|
CAS#: 84824-81-7 Product: 1-(4,6,6-Trimethyl-3-Cyclohexen-1-Yl)-2-Buten-1-One No suppilers available for the product. |
| Name | 1-(4,6,6-Trimethyl-3-Cyclohexen-1-Yl)-2-Buten-1-One |
|---|---|
| Synonyms | 1-(4,6,6-Trimethyl-3-Cyclohexen-1-Yl)-2-Buten-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 |
| CAS Registry Number | 84824-81-7 |
| EINECS | 284-233-5 |
| SMILES | CC1(C(C(=O)\C=C\C)CC=C(C1)C)C |
| InChI | 1S/C13H20O/c1-5-6-12(14)11-8-7-10(2)9-13(11,3)4/h5-7,11H,8-9H2,1-4H3/b6-5+ |
| InChIKey | RPBGCXLSUJNODQ-AATRIKPKSA-N |
| Density | 0.898g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.126°C at 760 mmHg (Cal.) |
| Flash point | 105.731°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4,6,6-Trimethyl-3-Cyclohexen-1-Yl)-2-Buten-1-One |