|
CAS#: 84836-32-8 Product: 2-Ethyl-1-(4-Methoxyphenyl)Butan-1-One No suppilers available for the product. |
| Name | 2-Ethyl-1-(4-Methoxyphenyl)Butan-1-One |
|---|---|
| Synonyms | Nsc57535 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 |
| CAS Registry Number | 84836-32-8 |
| SMILES | C1=C(OC)C=CC(=C1)C(=O)C(CC)CC |
| InChI | 1S/C13H18O2/c1-4-10(5-2)13(14)11-6-8-12(15-3)9-7-11/h6-10H,4-5H2,1-3H3 |
| InChIKey | CUSGBLIMZVLLIE-UHFFFAOYSA-N |
| Density | 0.976g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.812°C at 760 mmHg (Cal.) |
| Flash point | 130.175°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethyl-1-(4-Methoxyphenyl)Butan-1-One |