Online Database of Chemicals from Around the World
|
CAS#: 84852-54-0 Product: Pentabromo-N-(Pentabromophenyl)Aniline No suppilers available for the product. |
| Name | Pentabromo-N-(Pentabromophenyl)Aniline |
|---|---|
| Synonyms | Bis(2,3,4,5,6-Pentabromophenyl)Amine; Pentabromo-N-(Pentabromophenyl)Aniline |
| Molecular Structure |  |
| Molecular Formula | C12HBr10N |
| Molecular Weight | 958.19 |
| CAS Registry Number | 84852-54-0 |
| EINECS | 284-367-4 |
| SMILES | C2(=C(Br)C(=C(NC1=C(Br)C(=C(Br)C(=C1Br)Br)Br)C(=C2Br)Br)Br)Br |
| InChI | 1S/C12HBr10N/c13-1-3(15)7(19)11(8(20)4(1)16)23-12-9(21)5(17)2(14)6(18)10(12)22/h23H |
| InChIKey | OQXYDDOXOUGYNX-UHFFFAOYSA-N |
| Density | 3.02g/cm3 (Cal.) |
|---|---|
| Boiling point | 552.871°C at 760 mmHg (Cal.) |
| Flash point | 288.166°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pentabromo-N-(Pentabromophenyl)Aniline |