|
CAS#: 84852-33-5 Product: 2'-Sulfanyl-2,6,6'-trithioxo-2,3,5,5',6,6'-hexahydro-4H,4'H-3,3'-bithiopyran-4,4'-dione No suppilers available for the product. |
| Name | 2'-Sulfanyl-2,6,6'-trithioxo-2,3,5,5',6,6'-hexahydro-4H,4'H-3,3'-bithiopyran-4,4'-dione |
|---|---|
| Synonyms | 2,3,5,5', |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6O2S6 |
| Molecular Weight | 350.54 |
| CAS Registry Number | 84852-33-5 |
| EINECS | 284-344-9 |
| SMILES | SC=2SC(=S)CC(=O)C=2C1C(=S)SC(=S)CC1=O |
| InChI | 1S/C10H6O2S6/c11-3-1-5(13)17-9(15)7(3)8-4(12)2-6(14)18-10(8)16/h7,16H,1-2H2 |
| InChIKey | OMLAZTBGQFDFOE-UHFFFAOYSA-N |
| Density | 1.733g/cm3 (Cal.) |
|---|---|
| Boiling point | 560.776°C at 760 mmHg (Cal.) |
| Flash point | 292.947°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2'-Sulfanyl-2,6,6'-trithioxo-2,3,5,5',6,6'-hexahydro-4H,4'H-3,3'-bithiopyran-4,4'-dione |