|
CAS#: 84852-56-2 Product: Perbromophenyl 3-Methyl-2-Butenoate No suppilers available for the product. |
| Name | Perbromophenyl 3-Methyl-2-Butenoate |
|---|---|
| Synonyms | 3-Methylbut-2-Enoic Acid (2,3,4,5,6-Pentabromophenyl) Ester; Perbromophenyl 3-Methyl-2-Butenoate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H7Br5O2 |
| Molecular Weight | 570.70 |
| CAS Registry Number | 84852-56-2 |
| EINECS | 284-370-0 |
| SMILES | CC(=CC(OC1=C(Br)C(=C(Br)C(=C1Br)Br)Br)=O)C |
| InChI | 1S/C11H7Br5O2/c1-4(2)3-5(17)18-11-9(15)7(13)6(12)8(14)10(11)16/h3H,1-2H3 |
| InChIKey | YIEYHONIUQPZAZ-UHFFFAOYSA-N |
| Density | 2.274g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.476°C at 760 mmHg (Cal.) |
| Flash point | 249.826°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Perbromophenyl 3-Methyl-2-Butenoate |