Online Database of Chemicals from Around the World
|
CAS#: 84852-57-3 Product: 2,4,6-Tribromophenyl 2-Ethylhexanoate No suppilers available for the product. |
| Name | 2,4,6-Tribromophenyl 2-Ethylhexanoate |
|---|---|
| Synonyms | 2-Ethylhexanoic Acid (2,4,6-Tribromophenyl) Ester; 2,4,6-Tribromophenyl 2-Ethylhexanoate |
| Molecular Structure |  |
| Molecular Formula | C14H17Br3O2 |
| Molecular Weight | 457.00 |
| CAS Registry Number | 84852-57-3 |
| EINECS | 284-371-6 |
| SMILES | C1=C(Br)C=C(Br)C(=C1Br)OC(=O)C(CCCC)CC |
| InChI | 1S/C14H17Br3O2/c1-3-5-6-9(4-2)14(18)19-13-11(16)7-10(15)8-12(13)17/h7-9H,3-6H2,1-2H3 |
| InChIKey | HQVZMRPSXXNTNQ-UHFFFAOYSA-N |
| Density | 1.662g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.745°C at 760 mmHg (Cal.) |
| Flash point | 208.259°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,6-Tribromophenyl 2-Ethylhexanoate |