|
CAS#: 84864-61-9 Product: Potassium Phenylglycolate No suppilers available for the product. |
| Name | Potassium Phenylglycolate |
|---|---|
| Synonyms | Potassium 2-Hydroxy-2-Phenyl-Acetate; Potassium 2-Hydroxy-2-Phenyl-Ethanoate; Potassium Phenylglycolate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7KO3 |
| Molecular Weight | 190.24 |
| CAS Registry Number | 84864-61-9 |
| EINECS | 284-384-7 |
| SMILES | C1=C(C(O)C([O-])=O)C=CC=C1.[K+] |
| InChI | 1S/C8H8O3.K/c9-7(8(10)11)6-4-2-1-3-5-6;/h1-5,7,9H,(H,10,11);/q;+1/p-1 |
| InChIKey | UXIPJZUVTLMZBG-UHFFFAOYSA-M |
| Boiling point | 321.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 162.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium Phenylglycolate |