|
CAS#: 84864-55-1 Product: (3,7,7-Trimethylbicyclo[4.1.0]hept-3-en-2-yl)methyl acetate No suppilers available for the product. |
| Name | (3,7,7-Trimethylbicyclo[4.1.0]hept-3-en-2-yl)methyl acetate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 |
| CAS Registry Number | 84864-55-1 |
| EINECS | 284-377-9 |
| SMILES | CC2(C)C1CC=C(C)C(COC(C)=O)C12 |
| InChI | 1S/C13H20O2/c1-8-5-6-11-12(13(11,3)4)10(8)7-15-9(2)14/h5,10-12H,6-7H2,1-4H3 |
| InChIKey | MJGOVIGTDWZKNJ-UHFFFAOYSA-N |
| Density | 0.98g/cm3 (Cal.) |
|---|---|
| Boiling point | 250.679°C at 760 mmHg (Cal.) |
| Flash point | 88.235°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3,7,7-Trimethylbicyclo[4.1.0]hept-3-en-2-yl)methyl acetate |