|
CAS#: 84872-35-5 Product: 1-Methyl-9H-pyrido(3,4-b)indol-3-amine No suppilers available for the product. |
| Name | 1-Methyl-9H-pyrido(3,4-b)indol-3-amine |
|---|---|
| Synonyms | Brn 0175074; 1-Methyl-9H-Pyrido(3,4-B)Indol-3-Amine; (1-Methyl-9H-$B-Carbolin-3-Yl)Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 |
| CAS Registry Number | 84872-35-5 |
| SMILES | C1=CC=CC2=C1[NH]C3=C2C=C(N)N=C3C |
| InChI | 1S/C12H11N3/c1-7-12-9(6-11(13)14-7)8-4-2-3-5-10(8)15-12/h2-6,15H,1H3,(H2,13,14) |
| InChIKey | GOLPAGXAGCWCAN-UHFFFAOYSA-N |
| Density | 1.335g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.662°C at 760 mmHg (Cal.) |
| Flash point | 260.108°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-9H-pyrido(3,4-b)indol-3-amine |