|
CAS#: 84878-53-5 Product: 4-(2,6-Dimethylhepta-1,5-Dienyl)Heptane-2,6-Dione No suppilers available for the product. |
| Name | 4-(2,6-Dimethylhepta-1,5-Dienyl)Heptane-2,6-Dione |
|---|---|
| Synonyms | 4-(2,6-Dimethylhepta-1,5-Dienyl)Heptane-2,6-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 |
| CAS Registry Number | 84878-53-5 |
| EINECS | 284-446-3 |
| SMILES | C(C(\C=C(\CCC=C(C)C)C)CC(=O)C)C(=O)C |
| InChI | 1S/C16H26O2/c1-12(2)7-6-8-13(3)9-16(10-14(4)17)11-15(5)18/h7,9,16H,6,8,10-11H2,1-5H3/b13-9+ |
| InChIKey | VQJBKPGRSJADAG-UKTHLTGXSA-N |
| Density | 0.913g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.716°C at 760 mmHg (Cal.) |
| Flash point | 140.189°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2,6-Dimethylhepta-1,5-Dienyl)Heptane-2,6-Dione |