|
CAS#: 84888-75-5 Product: 2-Methylcysteinesulfinic Acid No suppilers available for the product. |
| Name | 2-Methylcysteinesulfinic Acid |
|---|---|
| Synonyms | (2R)-2-Amino-2-Methyl-3-Sulfino-Propanoic Acid; (2R)-2-Amino-2-Methyl-3-Sulfino-Propionic Acid; Alpha-Methylcysteinesulfinic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C4H9NO4S |
| Molecular Weight | 167.18 |
| CAS Registry Number | 84888-75-5 |
| SMILES | [C@@](C(=O)O)(N)(C[S](=O)O)C |
| InChI | 1S/C4H9NO4S/c1-4(5,3(6)7)2-10(8)9/h2,5H2,1H3,(H,6,7)(H,8,9)/t4-/m0/s1 |
| InChIKey | RHJTXIFKACRYOA-BYPYZUCNSA-N |
| Density | 1.673g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.722°C at 760 mmHg (Cal.) |
| Flash point | 224.575°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methylcysteinesulfinic Acid |