|
CAS#: 84912-11-8 Product: Methyl 2-Acetyl-3-Methyl-4-Oxovalerate No suppilers available for the product. |
| Name | Methyl 2-Acetyl-3-Methyl-4-Oxovalerate |
|---|---|
| Synonyms | Methyl 2-Acetyl-3-Methyl-4-Oxo-Pentanoate; 2-Acetyl-3-Methyl-4-Oxopentanoic Acid Methyl Ester; 2-Acetyl-4-Keto-3-Methyl-Valeric Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 |
| CAS Registry Number | 84912-11-8 |
| EINECS | 284-474-6 |
| SMILES | COC(=O)C(C(=O)C)C(C(=O)C)C |
| InChI | 1S/C9H14O4/c1-5(6(2)10)8(7(3)11)9(12)13-4/h5,8H,1-4H3 |
| InChIKey | ICETZAWQGQSRCU-UHFFFAOYSA-N |
| Density | 1.061g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.328°C at 760 mmHg (Cal.) |
| Flash point | 120.584°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-Acetyl-3-Methyl-4-Oxovalerate |