|
CAS#: 84930-15-4 Product: Sodium Isobutyl 4-Oxidobenzoate No suppilers available for the product. |
| Name | Sodium Isobutyl 4-Oxidobenzoate |
|---|---|
| Synonyms | Sodium 4-Isobutoxycarbonylphenolate; Sodium 4-(Isobutoxy-Oxomethyl)Phenolate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NaO3 |
| Molecular Weight | 216.21 |
| CAS Registry Number | 84930-15-4 |
| EINECS | 284-595-4 |
| SMILES | C1=C(C(OCC(C)C)=O)C=CC(=C1)[O-].[Na+] |
| InChI | 1S/C11H14O3.Na/c1-8(2)7-14-11(13)9-3-5-10(12)6-4-9;/h3-6,8,12H,7H2,1-2H3;/q;+1/p-1 |
| InChIKey | HLDPLHCMNIULPL-UHFFFAOYSA-M |
| Boiling point | 302.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 125.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium Isobutyl 4-Oxidobenzoate |