|
CAS#: 84946-10-1 Product: 2-(2,4-Dichlorophenyl)-2-Methyl-1,3-Dioxolane No suppilers available for the product. |
| Name | 2-(2,4-Dichlorophenyl)-2-Methyl-1,3-Dioxolane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H10Cl2O2 |
| Molecular Weight | 233.09 |
| CAS Registry Number | 84946-10-1 |
| EINECS | 284-613-0 |
| SMILES | C1=CC(=CC(=C1C2(OCCO2)C)Cl)Cl |
| InChI | 1S/C10H10Cl2O2/c1-10(13-4-5-14-10)8-3-2-7(11)6-9(8)12/h2-3,6H,4-5H2,1H3 |
| InChIKey | HAXWHYNRHOLHCE-UHFFFAOYSA-N |
| Density | 1.315g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.319°C at 760 mmHg (Cal.) |
| Flash point | 115.377°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,4-Dichlorophenyl)-2-Methyl-1,3-Dioxolane |