|
CAS#: 84962-71-0 Product: 2,4-Dimethyl-2-(3,5,5-Trimethyl-2-Cyclohexen-1-Yl)-1,3-Dioxolane No suppilers available for the product. |
| Name | 2,4-Dimethyl-2-(3,5,5-Trimethyl-2-Cyclohexen-1-Yl)-1,3-Dioxolane |
|---|---|
| Synonyms | 2,4-Dimethyl-2-(3,5,5-Trimethyl-2-Cyclohexen-1-Yl)-1,3-Dioxolane |
| Molecular Structure | ![]() |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 |
| CAS Registry Number | 84962-71-0 |
| EINECS | 284-770-5 |
| SMILES | CC1(OC(CO1)C)C2CC(CC(=C2)C)(C)C |
| InChI | 1S/C14H24O2/c1-10-6-12(8-13(3,4)7-10)14(5)15-9-11(2)16-14/h6,11-12H,7-9H2,1-5H3 |
| InChIKey | XODOBODQNVUHDA-UHFFFAOYSA-N |
| Density | 0.939g/cm3 (Cal.) |
|---|---|
| Boiling point | 268.79°C at 760 mmHg (Cal.) |
| Flash point | 121.021°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Dimethyl-2-(3,5,5-Trimethyl-2-Cyclohexen-1-Yl)-1,3-Dioxolane |