|
CAS#: 85006-34-4 Product: 3,5,5-Trimethylhexyl Dihydrogen Phosphate No suppilers available for the product. |
| Name | 3,5,5-Trimethylhexyl Dihydrogen Phosphate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H21O4P |
| Molecular Weight | 224.24 |
| CAS Registry Number | 85006-34-4 |
| EINECS | 285-063-4 |
| SMILES | C(O[P](O)(O)=O)CC(CC(C)(C)C)C |
| InChI | 1S/C9H21O4P/c1-8(7-9(2,3)4)5-6-13-14(10,11)12/h8H,5-7H2,1-4H3,(H2,10,11,12) |
| InChIKey | CPVSQXHMFHZDCI-UHFFFAOYSA-N |
| Density | 1.104g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.495°C at 760 mmHg (Cal.) |
| Flash point | 150.049°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5,5-Trimethylhexyl Dihydrogen Phosphate |