|
CAS#: 85068-43-5 Product: 11,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl 10-undecenoate No suppilers available for the product. |
| Name | 11,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl 10-undecenoate |
|---|---|
| Synonyms | 11β,17,21 |
| Molecular Structure | ![]() |
| Molecular Formula | C32H48O6 |
| Molecular Weight | 528.72 |
| CAS Registry Number | 85068-43-5 |
| EINECS | 285-304-3 |
| SMILES | C=CCCCCCCCCC(=O)OCC(=O)[C@@]2(O)CC[C@H]1[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]12C |
| InChI | 1S/C32H48O6/c1-4-5-6-7-8-9-10-11-12-28(36)38-21-27(35)32(37)18-16-25-24-14-13-22-19-23(33)15-17-30(22,2)29(24)26(34)20-31(25,32)3/h4,19,24-26,29,34,37H,1,5-18,20-21H2,2-3H3/t24-,25-,26-,29+,30-,31-,32-/m0/s1 |
| InChIKey | ODTBRLYUJAOLAZ-RXBLAQSTSA-N |
| Density | 1.151g/cm3 (Cal.) |
|---|---|
| Boiling point | 662.447°C at 760 mmHg (Cal.) |
| Flash point | 206.196°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11,17-Dihydroxy-3,20-dioxopregn-4-en-21-yl 10-undecenoate |