|
CAS#: 85098-93-7 Product: Methyl 3-chloro-6-hydroxy-4-methoxy-2,5-dimethylbenzoate No suppilers available for the product. |
| Name | Methyl 3-chloro-6-hydroxy-4-methoxy-2,5-dimethylbenzoate |
|---|---|
| Synonyms | methyl 3-chloro-2,5-dimethyl-6-hydroxy-p-anisate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13ClO4 |
| Molecular Weight | 244.67 |
| CAS Registry Number | 85098-93-7 |
| EINECS | 285-447-1 |
| SMILES | COc1c(C)c(O)c(c(C)c1Cl)C(=O)OC |
| InChI | 1S/C11H13ClO4/c1-5-7(11(14)16-4)9(13)6(2)10(15-3)8(5)12/h13H,1-4H3 |
| InChIKey | ALHKAHMAUJFZGF-UHFFFAOYSA-N |
| Density | 1.26g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.137°C at 760 mmHg (Cal.) |
| Flash point | 165.557°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3-chloro-6-hydroxy-4-methoxy-2,5-dimethylbenzoate |