|
CAS#: 85099-22-5 Product: Sodium Isobutyl 2-Butenedioate No suppilers available for the product. |
| Name | Sodium Isobutyl 2-Butenedioate |
|---|---|
| Synonyms | Sodium (E)-4-Isobutoxy-4-Oxo-But-2-Enoate; Sodium (E)-4-Isobutoxy-4-Oxobut-2-Enoate; Sodium (E)-4-Isobutoxy-4-Keto-But-2-Enoate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H11NaO4 |
| Molecular Weight | 194.16 |
| CAS Registry Number | 85099-22-5 |
| EINECS | 285-477-5 |
| SMILES | C(OC(=O)\C=C\C([O-])=O)C(C)C.[Na+] |
| InChI | 1S/C8H12O4.Na/c1-6(2)5-12-8(11)4-3-7(9)10;/h3-4,6H,5H2,1-2H3,(H,9,10);/q;+1/p-1/b4-3+; |
| InChIKey | NOPQDTLCPQHNRM-BJILWQEISA-M |
| Boiling point | 281.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 110°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium Isobutyl 2-Butenedioate |