|
CAS#: 85099-37-2 Product: 2-Ethoxy-5-Hydrazinobenzenesulphonic Acid No suppilers available for the product. |
| Name | 2-Ethoxy-5-Hydrazinobenzenesulphonic Acid |
|---|---|
| Synonyms | 2-Ethoxy-5-Hydrazino-Benzenesulfonic Acid; 2-Ethoxy-5-Hydrazinobenzenesulfonic Acid; 2-Ethoxy-5-Hydrazinyl-Benzenesulfonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12N2O4S |
| Molecular Weight | 232.25 |
| CAS Registry Number | 85099-37-2 |
| EINECS | 285-493-2 |
| SMILES | C1=C(NN)C=CC(=C1[S](=O)(=O)O)OCC |
| InChI | 1S/C8H12N2O4S/c1-2-14-7-4-3-6(10-9)5-8(7)15(11,12)13/h3-5,10H,2,9H2,1H3,(H,11,12,13) |
| InChIKey | VNVDWWIHAKFXCI-UHFFFAOYSA-N |
| Density | 1.458g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Ethoxy-5-Hydrazinobenzenesulphonic Acid |