|
CAS#: 85118-22-5 Product: 2-Bromo-1-[Chloro(4-Fluorophenyl)Methyl]-4-(Trifluoromethyl)Benzene No suppilers available for the product. |
| Name | 2-Bromo-1-[Chloro(4-Fluorophenyl)Methyl]-4-(Trifluoromethyl)Benzene |
|---|---|
| Synonyms | 2-Bromo-1-(Chloro(4-Fluorophenyl)Methyl)-4-(Trifluoromethyl)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8BrClF4 |
| Molecular Weight | 367.57 |
| CAS Registry Number | 85118-22-5 |
| EINECS | 285-675-1 |
| SMILES | C1=C(C(F)(F)F)C=CC(=C1Br)C(Cl)C2=CC=C(F)C=C2 |
| InChIKey | NQCHPKLCVPHTBF-UHFFFAOYSA-N |
| Density | 1.565g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.997°C at 760 mmHg (Cal.) |
| Flash point | 164.263°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Bromo-1-[Chloro(4-Fluorophenyl)Methyl]-4-(Trifluoromethyl)Benzene |