Online Database of Chemicals from Around the World
|
CAS#: 851224-80-1 Product: ethyl 3-[4-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-5-carboxylate No suppilers available for the product. |
| Name | ethyl 3-[4-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-5-carboxylate |
|---|---|
| Synonyms | 1,2,4-Thi |
| Molecular Structure | ![CAS#: 851224-80-1, ethyl 3-[4-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-5-carboxylate](/moreStructures/851224-80-1.gif) |
| Molecular Formula | C12H9F3N2O2S |
| Molecular Weight | 302.27 |
| CAS Registry Number | 851224-80-1 |
| SMILES | FC(F)(F)c1ccc(cc1)c2nc(sn2)C(=O)OCC |
| InChI | 1S/C12H9F3N2O2S/c1-2-19-11(18)10-16-9(17-20-10)7-3-5-8(6-4-7)12(13,14)15/h3-6H,2H2,1H3 |
| InChIKey | OZPIJQDPXKMQHJ-UHFFFAOYSA-N |
| Density | 1.383g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.603°C at 760 mmHg (Cal.) |
| Flash point | 176.12°C (Cal.) |
| Refractive index | 1.523 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for ethyl 3-[4-(trifluoromethyl)phenyl]-1,2,4-thiadiazole-5-carboxylate |