|
CAS#: 85153-68-0 Product: Methyl 2,2,4-Trichloro-3-Oxobutyrate No suppilers available for the product. |
| Name | Methyl 2,2,4-Trichloro-3-Oxobutyrate |
|---|---|
| Synonyms | Methyl 2,2,4-Trichloro-3-Oxo-Butanoate; 2,2,4-Trichloro-3-Oxobutanoic Acid Methyl Ester; 2,2,4-Trichloro-3-Keto-Butyric Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C5H5Cl3O3 |
| Molecular Weight | 219.45 |
| CAS Registry Number | 85153-68-0 |
| EINECS | 285-851-8 |
| SMILES | C(Cl)C(=O)C(Cl)(Cl)C(OC)=O |
| InChI | 1S/C5H5Cl3O3/c1-11-4(10)5(7,8)3(9)2-6/h2H2,1H3 |
| InChIKey | IQTNMFRCFNHMHF-UHFFFAOYSA-N |
| Density | 1.504g/cm3 (Cal.) |
|---|---|
| Boiling point | 226.944°C at 760 mmHg (Cal.) |
| Flash point | 92.246°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2,2,4-Trichloro-3-Oxobutyrate |