|
CAS#: 85168-92-9 Product: 1,3-Pentadiene-2,4-diyl diacetate No suppilers available for the product. |
| Name | 1,3-Pentadiene-2,4-diyl diacetate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 |
| CAS Registry Number | 85168-92-9 |
| EINECS | 285-934-9 |
| SMILES | CC(=O)OC(=C)C=C(C)OC(C)=O |
| InChI | 1S/C9H12O4/c1-6(12-8(3)10)5-7(2)13-9(4)11/h5H,1H2,2-4H3 |
| InChIKey | WKYIJSKXLFGLAN-UHFFFAOYSA-N |
| Density | 1.069g/cm3 (Cal.) |
|---|---|
| Boiling point | 225.702°C at 760 mmHg (Cal.) |
| Flash point | 102.929°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Pentadiene-2,4-diyl diacetate |