|
CAS#: 85187-12-8 Product: 5,7,7-Trimethyloct-2-Enoic Acid No suppilers available for the product. |
| Name | 5,7,7-Trimethyloct-2-Enoic Acid |
|---|---|
| Synonyms | 5,7,7-Trimethyloct-2-Enoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 |
| CAS Registry Number | 85187-12-8 |
| EINECS | 286-099-3 |
| SMILES | C(C(C)(C)C)C(C\C=C\C(=O)O)C |
| InChI | 1S/C11H20O2/c1-9(8-11(2,3)4)6-5-7-10(12)13/h5,7,9H,6,8H2,1-4H3,(H,12,13)/b7-5+ |
| InChIKey | PUKIIUAGWAFYPN-FNORWQNLSA-N |
| Density | 0.927g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.38°C at 760 mmHg (Cal.) |
| Flash point | 183.819°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,7,7-Trimethyloct-2-Enoic Acid |