|
CAS#: 85187-20-8 Product: 4-(2,2,3-Trimethyl-3-cyclopenten-1-yl)-2-butenoic acid No suppilers available for the product. |
| Name | 4-(2,2,3-Trimethyl-3-cyclopenten-1-yl)-2-butenoic acid |
|---|---|
| Synonyms | 4-(2,2,3-trimethyl-3-cyclopenten-1-yl)butenoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 |
| CAS Registry Number | 85187-20-8 |
| EINECS | 286-108-0 |
| SMILES | OC(=O)C=CCC1C\C=C(\C)C1(C)C |
| InChI | 1S/C12H18O2/c1-9-7-8-10(12(9,2)3)5-4-6-11(13)14/h4,6-7,10H,5,8H2,1-3H3,(H,13,14) |
| InChIKey | YRIPPWABYROTJJ-UHFFFAOYSA-N |
| Density | 0.985g/cm3 (Cal.) |
|---|---|
| Boiling point | 302.838°C at 760 mmHg (Cal.) |
| Flash point | 208.227°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2,2,3-Trimethyl-3-cyclopenten-1-yl)-2-butenoic acid |