|
CAS#: 85204-18-8 Product: 1-(3,3-Dimethylbicyclo[2.2.1]hept-5-en-2-yl)ethyl acetate No suppilers available for the product. |
| Name | 1-(3,3-Dimethylbicyclo[2.2.1]hept-5-en-2-yl)ethyl acetate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 |
| CAS Registry Number | 85204-18-8 |
| EINECS | 286-313-5 |
| SMILES | CC2(C)C1C=CC(C1)C2C(C)OC(C)=O |
| InChI | 1S/C13H20O2/c1-8(15-9(2)14)12-10-5-6-11(7-10)13(12,3)4/h5-6,8,10-12H,7H2,1-4H3 |
| InChIKey | ASHKOXCVKJACGB-UHFFFAOYSA-N |
| Density | 0.997g/cm3 (Cal.) |
|---|---|
| Boiling point | 248.197°C at 760 mmHg (Cal.) |
| Flash point | 86.51°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,3-Dimethylbicyclo[2.2.1]hept-5-en-2-yl)ethyl acetate |