|
CAS#: 85204-28-0 Product: 3-Tert-Butyl-5-Methylbenzyl Alcohol No suppilers available for the product. |
| Name | 3-Tert-Butyl-5-Methylbenzyl Alcohol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 |
| CAS Registry Number | 85204-28-0 |
| EINECS | 286-324-5 |
| SMILES | C1=C(C=C(C=C1C(C)(C)C)C)CO |
| InChI | 1S/C12H18O/c1-9-5-10(8-13)7-11(6-9)12(2,3)4/h5-7,13H,8H2,1-4H3 |
| InChIKey | QOKKZXRTROQJFO-UHFFFAOYSA-N |
| Density | 0.957g/cm3 (Cal.) |
|---|---|
| Boiling point | 232.591°C at 760 mmHg (Cal.) |
| Flash point | 101.385°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Tert-Butyl-5-Methylbenzyl Alcohol |