|
CAS#: 85226-25-1 Product: N-(3-chloropropyl)-3,4-dimethoxy-N-methyl-Benzeneethanaminium ethanedioate (1:1) No suppilers available for the product. |
| Name | N-(3-chloropropyl)-3,4-dimethoxy-N-methyl-Benzeneethanaminium ethanedioate (1:1) |
|---|---|
| Synonyms | (3-chloro |
| Molecular Structure | ![]() |
| Molecular Formula | C16H23ClNO6 |
| Molecular Weight | 360.81 |
| CAS Registry Number | 85226-25-1 |
| EINECS | 286-396-8 |
| SMILES | COc1cc(ccc1OC)CC[NH+](C)CCCCl.[O-]C(=O)C([O-])=O |
| InChI | 1S/C14H22ClNO2.C2H2O4/c1-16(9-4-8-15)10-7-12-5-6-13(17-2)14(11-12)18-3;3-1(4)2(5)6/h5-6,11H,4,7-10H2,1-3H3;(H,3,4)(H,5,6)/p-1 |
| InChIKey | RHWJLYYZGLGWDX-UHFFFAOYSA-M |
| Boiling point | 535.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 277.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3-chloropropyl)-3,4-dimethoxy-N-methyl-Benzeneethanaminium ethanedioate (1:1) |