Online Database of Chemicals from Around the World
|
CAS#: 85275-59-8 Product: Desmethyletimizol No suppilers available for the product. |
| Name | Desmethyletimizol |
|---|---|
| Synonyms | 1-Ethyl-4-Carbamoyl-5-Methylcarbamoylimidazole; 1-Ethyl-N(Sup 5)-Methyl-1H-Imidazole-4,5-Dicarboxamide; 1-Ethyl-N'-Methyl-Imidazole-4,5-Dicarboxamide |
| Molecular Structure |  |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 |
| CAS Registry Number | 85275-59-8 |
| SMILES | C1=NC(=C([N]1CC)C(NC)=O)C(N)=O |
| InChI | 1S/C8H12N4O2/c1-3-12-4-11-5(7(9)13)6(12)8(14)10-2/h4H,3H2,1-2H3,(H2,9,13)(H,10,14) |
| InChIKey | HMGGQLSRJXFGRN-UHFFFAOYSA-N |
| Density | 1.375g/cm3 (Cal.) |
|---|---|
| Boiling point | 560.013°C at 760 mmHg (Cal.) |
| Flash point | 292.485°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Desmethyletimizol |