|
CAS#: 85305-28-8 Product: Bis(1,3-Dihydroxybutyl)Benzenediol No suppilers available for the product. |
| Name | Bis(1,3-Dihydroxybutyl)Benzenediol |
|---|---|
| Synonyms | 3,4-Bis(1,3-Dihydroxybutyl)Pyrocatechol; Bis(1,3-Dihydroxybutyl)Benzenediol |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 |
| CAS Registry Number | 85305-28-8 |
| EINECS | 286-666-5 |
| SMILES | C1=CC(=C(O)C(=C1C(O)CC(O)C)C(O)CC(O)C)O |
| InChI | 1S/C14H22O6/c1-7(15)5-11(18)9-3-4-10(17)14(20)13(9)12(19)6-8(2)16/h3-4,7-8,11-12,15-20H,5-6H2,1-2H3 |
| InChIKey | LLYJFEWETFSPJK-UHFFFAOYSA-N |
| Density | 1.362g/cm3 (Cal.) |
|---|---|
| Boiling point | 577.394°C at 760 mmHg (Cal.) |
| Flash point | 278.887°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(1,3-Dihydroxybutyl)Benzenediol |