|
CAS#: 85369-28-4 Product: N-(9H-Fluoren-9-Ylacetyl)-S-Methylcysteine No suppilers available for the product. |
| Name | N-(9H-Fluoren-9-Ylacetyl)-S-Methylcysteine |
|---|---|
| Synonyms | (2R)-2-[[2-(9H-Fluoren-9-Yl)Acetyl]Amino]-3-Methylsulfanyl-Propanoic Acid; (2R)-2-[[2-(9H-Fluoren-9-Yl)-1-Oxoethyl]Amino]-3-(Methylthio)Propanoic Acid; (2R)-2-[[2-(9H-Fluoren-9-Yl)Acetyl]Amino]-3-(Methylthio)Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C19H19NO3S |
| Molecular Weight | 341.42 |
| CAS Registry Number | 85369-28-4 |
| SMILES | [C@H](C(=O)O)(NC(=O)CC2C1=C(C=CC=C1)C3=C2C=CC=C3)CSC |
| InChI | 1S/C19H19NO3S/c1-24-11-17(19(22)23)20-18(21)10-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,16-17H,10-11H2,1H3,(H,20,21)(H,22,23)/t17-/m0/s1 |
| InChIKey | AYTUWLODZRLRAV-KRWDZBQOSA-N |
| Density | 1.279g/cm3 (Cal.) |
|---|---|
| Boiling point | 629.943°C at 760 mmHg (Cal.) |
| Flash point | 334.777°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(9H-Fluoren-9-Ylacetyl)-S-Methylcysteine |