|
CAS#: 85391-88-4 Product: (2E)-3-(3,3-Dimethylbicyclo[2.2.1]hept-2-yl)acrylic acid No suppilers available for the product. |
| Name | (2E)-3-(3,3-Dimethylbicyclo[2.2.1]hept-2-yl)acrylic acid |
|---|---|
| Synonyms | 3-(3,3-dimethylbicyclo[2.2.1]hept-2-yl)acrylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 |
| CAS Registry Number | 85391-88-4 |
| EINECS | 286-844-2 |
| SMILES | O=C(O)\C=C\C2C1CCC(C1)C2(C)C |
| InChI | 1S/C12H18O2/c1-12(2)9-4-3-8(7-9)10(12)5-6-11(13)14/h5-6,8-10H,3-4,7H2,1-2H3,(H,13,14)/b6-5+ |
| InChIKey | XSLQITRSSLYXKT-AATRIKPKSA-N |
| Density | 1.116g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.151°C at 760 mmHg (Cal.) |
| Flash point | 214.195°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2E)-3-(3,3-Dimethylbicyclo[2.2.1]hept-2-yl)acrylic acid |