|
CAS#: 85409-80-9 Product: 2,4,6-Tris[(dimethylamino)methyl]phenol acetate (1:1) No suppilers available for the product. |
| Name | 2,4,6-Tris[(dimethylamino)methyl]phenol acetate (1:1) |
|---|---|
| Synonyms | 2,4,6-tris[(dimethylamino)methyl]phenol monoacetate |
| Molecular Structure | ![]() |
| Molecular Formula | C17H31N3O3 |
| Molecular Weight | 325.45 |
| CAS Registry Number | 85409-80-9 |
| EINECS | 287-151-8 |
| SMILES | Oc1c(cc(cc1CN(C)C)CN(C)C)CN(C)C.CC(O)=O |
| InChI | 1S/C15H27N3O.C2H4O2/c1-16(2)9-12-7-13(10-17(3)4)15(19)14(8-12)11-18(5)6;1-2(3)4/h7-8,19H,9-11H2,1-6H3;1H3,(H,3,4) |
| InChIKey | NSSNYIULMLAKQW-UHFFFAOYSA-N |
| Boiling point | 429.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 213.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,6-Tris[(dimethylamino)methyl]phenol acetate (1:1) |