|
CAS#: 85423-04-7 Product: 4-[(2-Aminophenyl)Methyl]-2-Ethylaniline No suppilers available for the product. |
| Name | 4-[(2-Aminophenyl)Methyl]-2-Ethylaniline |
|---|---|
| Synonyms | 4-[(2-Aminophenyl)Methyl]-2-Ethyl-Aniline; [4-(2-Aminobenzyl)-2-Ethyl-Phenyl]Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 |
| CAS Registry Number | 85423-04-7 |
| EINECS | 287-207-1 |
| SMILES | C2=C(CC1=C(N)C=CC=C1)C=CC(=C2CC)N |
| InChI | 1S/C15H18N2/c1-2-12-9-11(7-8-15(12)17)10-13-5-3-4-6-14(13)16/h3-9H,2,10,16-17H2,1H3 |
| InChIKey | XBAQBQBQYUPROQ-UHFFFAOYSA-N |
| Density | 1.098g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.841°C at 760 mmHg (Cal.) |
| Flash point | 239.091°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(2-Aminophenyl)Methyl]-2-Ethylaniline |